C21H17F3N4O4 — CID 18548843
[5-methyl-2-[[3-oxo-3-(3-pyrazol-1-ylphenyl)propanoyl]amino]-4-(trifluoromethyl)phenyl]carbamic acid (PubChem CID 18548843) has the molecular formula C21H17F3N4O4 and a molecular weight of 446.39 g/mol. Its IUPAC name is [5-methyl-2-[[3-oxo-3-(3-pyrazol-1-ylphenyl)propanoyl]amino]-4-(trifluoromethyl)phenyl]carbamic acid.
| Compound Name | [5-methyl-2-[[3-oxo-3-(3-pyrazol-1-ylphenyl)propanoyl]amino]-4-(trifluoromethyl)phenyl]carbamic acid |
|---|---|
| PubChem CID | 18548843 |
| Molecular Formula | C21H17F3N4O4 |
| Molecular Weight | 446.39 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | [5-methyl-2-[[3-oxo-3-(3-pyrazol-1-ylphenyl)propanoyl]amino]-4-(trifluoromethyl)phenyl]carbamic acid |
| SMILES | Cc1cc(NC(=O)O)c(NC(=O)CC(=O)c2cccc(-n3cccn3)c2)cc1C(F)(F)F |
| InChI | InChI=1S/C21H17F3N4O4/c1-12-8-16(27-20(31)32)17(10-15(12)21(22,23)24)26-19(30)11-18(29)13-4-2-5-14(9-13)28-7-3-6-25-28/h2-10,27H,11H2,1H3,(H,26,30)(H,31,32) |
| InChIKey | AJTNNINWMTXCOR-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.39 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|