C27H25F3N4O5 — CID 22317322
[2-[[3-[3-(2-methyl-4-pyridinyl)phenyl]-3-oxopropanoyl]amino]-5-morpholin-4-yl-4-(trifluoromethyl)phenyl]carbamic acid (PubChem CID 22317322) has the molecular formula C27H25F3N4O5 and a molecular weight of 542.51 g/mol. Its IUPAC name is [2-[[3-[3-(2-methyl-4-pyridinyl)phenyl]-3-oxopropanoyl]amino]-5-morpholin-4-yl-4-(trifluoromethyl)phenyl]carbamic acid.
| Compound Name | [2-[[3-[3-(2-methyl-4-pyridinyl)phenyl]-3-oxopropanoyl]amino]-5-morpholin-4-yl-4-(trifluoromethyl)phenyl]carbamic acid |
|---|---|
| PubChem CID | 22317322 |
| Molecular Formula | C27H25F3N4O5 |
| Molecular Weight | 542.51 g/mol |
| Exact Mass | 542.18 |
| IUPAC Name | [2-[[3-[3-(2-methyl-4-pyridinyl)phenyl]-3-oxopropanoyl]amino]-5-morpholin-4-yl-4-(trifluoromethyl)phenyl]carbamic acid |
| SMILES | Cc1cc(-c2cccc(C(=O)CC(=O)Nc3cc(C(F)(F)F)c(N4CCOCC4)cc3NC(=O)O)c2)ccn1 |
| InChI | InChI=1S/C27H25F3N4O5/c1-16-11-18(5-6-31-16)17-3-2-4-19(12-17)24(35)15-25(36)32-21-13-20(27(28,29)30)23(14-22(21)33-26(37)38)34-7-9-39-10-8-34/h2-6,11-14,33H,7-10,15H2,1H3,(H,32,36)(H,37,38) |
| InChIKey | UCXWKYHXCSBAHQ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.51 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|