C27H26F3N3O6 — CID 22317702
[2-[[3-[3-(2,6-dimethyl-4-pyridinyl)phenyl]-3-oxopropanoyl]amino]-5-(2-methoxyethoxy)-4-(trifluoromethyl)phenyl]carbamic acid (PubChem CID 22317702) has the molecular formula C27H26F3N3O6 and a molecular weight of 545.51 g/mol. Its IUPAC name is [2-[[3-[3-(2,6-dimethyl-4-pyridinyl)phenyl]-3-oxopropanoyl]amino]-5-(2-methoxyethoxy)-4-(trifluoromethyl)phenyl]carbamic acid.
| Compound Name | [2-[[3-[3-(2,6-dimethyl-4-pyridinyl)phenyl]-3-oxopropanoyl]amino]-5-(2-methoxyethoxy)-4-(trifluoromethyl)phenyl]carbamic acid |
|---|---|
| PubChem CID | 22317702 |
| Molecular Formula | C27H26F3N3O6 |
| Molecular Weight | 545.51 g/mol |
| Exact Mass | 545.18 |
| IUPAC Name | [2-[[3-[3-(2,6-dimethyl-4-pyridinyl)phenyl]-3-oxopropanoyl]amino]-5-(2-methoxyethoxy)-4-(trifluoromethyl)phenyl]carbamic acid |
| SMILES | COCCOc1cc(NC(=O)O)c(NC(=O)CC(=O)c2cccc(-c3cc(C)nc(C)c3)c2)cc1C(F)(F)F |
| InChI | InChI=1S/C27H26F3N3O6/c1-15-9-19(10-16(2)31-15)17-5-4-6-18(11-17)23(34)14-25(35)32-21-12-20(27(28,29)30)24(39-8-7-38-3)13-22(21)33-26(36)37/h4-6,9-13,33H,7-8,14H2,1-3H3,(H,32,35)(H,36,37) |
| InChIKey | JKIFXGOESHHIHP-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 126.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.51 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|