C23H19F3N4O5 — CID 22317911
[5-ethoxy-2-[[3-oxo-3-(2-pyridin-3-yl-4-pyridinyl)propanoyl]amino]-4-(trifluoromethyl)phenyl]carbamic acid (PubChem CID 22317911) has the molecular formula C23H19F3N4O5 and a molecular weight of 488.42 g/mol. Its IUPAC name is [5-ethoxy-2-[[3-oxo-3-(2-pyridin-3-yl-4-pyridinyl)propanoyl]amino]-4-(trifluoromethyl)phenyl]carbamic acid.
| Compound Name | [5-ethoxy-2-[[3-oxo-3-(2-pyridin-3-yl-4-pyridinyl)propanoyl]amino]-4-(trifluoromethyl)phenyl]carbamic acid |
|---|---|
| PubChem CID | 22317911 |
| Molecular Formula | C23H19F3N4O5 |
| Molecular Weight | 488.42 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | [5-ethoxy-2-[[3-oxo-3-(2-pyridin-3-yl-4-pyridinyl)propanoyl]amino]-4-(trifluoromethyl)phenyl]carbamic acid |
| SMILES | CCOc1cc(NC(=O)O)c(NC(=O)CC(=O)c2ccnc(-c3cccnc3)c2)cc1C(F)(F)F |
| InChI | InChI=1S/C23H19F3N4O5/c1-2-35-20-10-18(30-22(33)34)17(9-15(20)23(24,25)26)29-21(32)11-19(31)13-5-7-28-16(8-13)14-4-3-6-27-12-14/h3-10,12,30H,2,11H2,1H3,(H,29,32)(H,33,34) |
| InChIKey | OAIUKYLIDMTNEC-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 130.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.42 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|