C25H23F3N4O4 — CID 86589463
tert-butyl N-[2-[[3-oxo-3-(2-pyridin-3-yl-4-pyridinyl)propanoyl]amino]-4-(trifluoromethyl)phenyl]carbamate (PubChem CID 86589463) has the molecular formula C25H23F3N4O4 and a molecular weight of 500.48 g/mol. Its IUPAC name is tert-butyl N-[2-[[3-oxo-3-(2-pyridin-3-yl-4-pyridinyl)propanoyl]amino]-4-(trifluoromethyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[2-[[3-oxo-3-(2-pyridin-3-yl-4-pyridinyl)propanoyl]amino]-4-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 86589463 |
| Molecular Formula | C25H23F3N4O4 |
| Molecular Weight | 500.48 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | tert-butyl N-[2-[[3-oxo-3-(2-pyridin-3-yl-4-pyridinyl)propanoyl]amino]-4-(trifluoromethyl)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(C(F)(F)F)cc1NC(=O)CC(=O)c1ccnc(-c2cccnc2)c1 |
| InChI | InChI=1S/C25H23F3N4O4/c1-24(2,3)36-23(35)32-18-7-6-17(25(26,27)28)12-20(18)31-22(34)13-21(33)15-8-10-30-19(11-15)16-5-4-9-29-14-16/h4-12,14H,13H2,1-3H3,(H,31,34)(H,32,35) |
| InChIKey | NZUUVGFYKKKXPB-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.48 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|