C30H30F3N3O5 — CID 87855350
tert-butyl N-[2-[[3-[3-(5-cyclopropyl-2-pyridinyl)phenyl]-3-oxopropanoyl]amino]-5-(2,2,2-trifluoroethoxy)phenyl]carbamate (PubChem CID 87855350) has the molecular formula C30H30F3N3O5 and a molecular weight of 569.58 g/mol. Its IUPAC name is tert-butyl N-[2-[[3-[3-(5-cyclopropyl-2-pyridinyl)phenyl]-3-oxopropanoyl]amino]-5-(2,2,2-trifluoroethoxy)phenyl]carbamate.
| Compound Name | tert-butyl N-[2-[[3-[3-(5-cyclopropyl-2-pyridinyl)phenyl]-3-oxopropanoyl]amino]-5-(2,2,2-trifluoroethoxy)phenyl]carbamate |
|---|---|
| PubChem CID | 87855350 |
| Molecular Formula | C30H30F3N3O5 |
| Molecular Weight | 569.58 g/mol |
| Exact Mass | 569.21 |
| IUPAC Name | tert-butyl N-[2-[[3-[3-(5-cyclopropyl-2-pyridinyl)phenyl]-3-oxopropanoyl]amino]-5-(2,2,2-trifluoroethoxy)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(OCC(F)(F)F)ccc1NC(=O)CC(=O)c1cccc(-c2ccc(C3CC3)cn2)c1 |
| InChI | InChI=1S/C30H30F3N3O5/c1-29(2,3)41-28(39)36-25-14-22(40-17-30(31,32)33)10-12-24(25)35-27(38)15-26(37)20-6-4-5-19(13-20)23-11-9-21(16-34-23)18-7-8-18/h4-6,9-14,16,18H,7-8,15,17H2,1-3H3,(H,35,38)(H,36,39) |
| InChIKey | MSXXVUXYPBYBGT-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.58 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|