C27H26F3N3O4 — CID 86589339
tert-butyl N-[5-methyl-2-[[3-oxo-3-(3-pyridin-3-ylphenyl)propanoyl]amino]-4-(trifluoromethyl)phenyl]carbamate (PubChem CID 86589339) has the molecular formula C27H26F3N3O4 and a molecular weight of 513.52 g/mol. Its IUPAC name is tert-butyl N-[5-methyl-2-[[3-oxo-3-(3-pyridin-3-ylphenyl)propanoyl]amino]-4-(trifluoromethyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[5-methyl-2-[[3-oxo-3-(3-pyridin-3-ylphenyl)propanoyl]amino]-4-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 86589339 |
| Molecular Formula | C27H26F3N3O4 |
| Molecular Weight | 513.52 g/mol |
| Exact Mass | 513.19 |
| IUPAC Name | tert-butyl N-[5-methyl-2-[[3-oxo-3-(3-pyridin-3-ylphenyl)propanoyl]amino]-4-(trifluoromethyl)phenyl]carbamate |
| SMILES | Cc1cc(NC(=O)OC(C)(C)C)c(NC(=O)CC(=O)c2cccc(-c3cccnc3)c2)cc1C(F)(F)F |
| InChI | InChI=1S/C27H26F3N3O4/c1-16-11-21(33-25(36)37-26(2,3)4)22(13-20(16)27(28,29)30)32-24(35)14-23(34)18-8-5-7-17(12-18)19-9-6-10-31-15-19/h5-13,15H,14H2,1-4H3,(H,32,35)(H,33,36) |
| InChIKey | WHWTYLKRJTZJQY-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.52 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|