C30H32F3N3O5 — CID 86589356
tert-butyl N-[5-ethoxy-2-[[3-[3-(6-ethyl-3-pyridinyl)phenyl]-3-oxopropanoyl]amino]-4-(trifluoromethyl)phenyl]carbamate (PubChem CID 86589356) has the molecular formula C30H32F3N3O5 and a molecular weight of 571.60 g/mol. Its IUPAC name is tert-butyl N-[5-ethoxy-2-[[3-[3-(6-ethyl-3-pyridinyl)phenyl]-3-oxopropanoyl]amino]-4-(trifluoromethyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[5-ethoxy-2-[[3-[3-(6-ethyl-3-pyridinyl)phenyl]-3-oxopropanoyl]amino]-4-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 86589356 |
| Molecular Formula | C30H32F3N3O5 |
| Molecular Weight | 571.60 g/mol |
| Exact Mass | 571.23 |
| IUPAC Name | tert-butyl N-[5-ethoxy-2-[[3-[3-(6-ethyl-3-pyridinyl)phenyl]-3-oxopropanoyl]amino]-4-(trifluoromethyl)phenyl]carbamate |
| SMILES | CCOc1cc(NC(=O)OC(C)(C)C)c(NC(=O)CC(=O)c2cccc(-c3ccc(CC)nc3)c2)cc1C(F)(F)F |
| InChI | InChI=1S/C30H32F3N3O5/c1-6-21-12-11-20(17-34-21)18-9-8-10-19(13-18)25(37)16-27(38)35-23-14-22(30(31,32)33)26(40-7-2)15-24(23)36-28(39)41-29(3,4)5/h8-15,17H,6-7,16H2,1-5H3,(H,35,38)(H,36,39) |
| InChIKey | ZRIAALBLUUSZKG-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.60 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|