C30H28F3N3O4 — CID 118586678
tert-butyl N-[2-[[3-(3-indol-1-ylphenyl)-3-oxopropanoyl]amino]-5-methyl-4-(trifluoromethyl)phenyl]carbamate (PubChem CID 118586678) has the molecular formula C30H28F3N3O4 and a molecular weight of 551.57 g/mol. Its IUPAC name is tert-butyl N-[2-[[3-(3-indol-1-ylphenyl)-3-oxopropanoyl]amino]-5-methyl-4-(trifluoromethyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[2-[[3-(3-indol-1-ylphenyl)-3-oxopropanoyl]amino]-5-methyl-4-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 118586678 |
| Molecular Formula | C30H28F3N3O4 |
| Molecular Weight | 551.57 g/mol |
| Exact Mass | 551.20 |
| IUPAC Name | tert-butyl N-[2-[[3-(3-indol-1-ylphenyl)-3-oxopropanoyl]amino]-5-methyl-4-(trifluoromethyl)phenyl]carbamate |
| SMILES | Cc1cc(NC(=O)OC(C)(C)C)c(NC(=O)CC(=O)c2cccc(-n3ccc4ccccc43)c2)cc1C(F)(F)F |
| InChI | InChI=1S/C30H28F3N3O4/c1-18-14-23(35-28(39)40-29(2,3)4)24(16-22(18)30(31,32)33)34-27(38)17-26(37)20-9-7-10-21(15-20)36-13-12-19-8-5-6-11-25(19)36/h5-16H,17H2,1-4H3,(H,34,38)(H,35,39) |
| InChIKey | PSVFEPWFTBGWRC-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.57 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|