C18H14BrF3N2O4 — CID 118577277
[2-[[3-(3-bromophenyl)-3-oxopropanoyl]amino]-5-methyl-4-(trifluoromethyl)phenyl]carbamic acid (PubChem CID 118577277) has the molecular formula C18H14BrF3N2O4 and a molecular weight of 459.22 g/mol. Its IUPAC name is [2-[[3-(3-bromophenyl)-3-oxopropanoyl]amino]-5-methyl-4-(trifluoromethyl)phenyl]carbamic acid.
| Compound Name | [2-[[3-(3-bromophenyl)-3-oxopropanoyl]amino]-5-methyl-4-(trifluoromethyl)phenyl]carbamic acid |
|---|---|
| PubChem CID | 118577277 |
| Molecular Formula | C18H14BrF3N2O4 |
| Molecular Weight | 459.22 g/mol |
| Exact Mass | 458.01 |
| IUPAC Name | [2-[[3-(3-bromophenyl)-3-oxopropanoyl]amino]-5-methyl-4-(trifluoromethyl)phenyl]carbamic acid |
| SMILES | Cc1cc(NC(=O)O)c(NC(=O)CC(=O)c2cccc(Br)c2)cc1C(F)(F)F |
| InChI | InChI=1S/C18H14BrF3N2O4/c1-9-5-13(24-17(27)28)14(7-12(9)18(20,21)22)23-16(26)8-15(25)10-3-2-4-11(19)6-10/h2-7,24H,8H2,1H3,(H,23,26)(H,27,28) |
| InChIKey | UDNURBZEANTYDB-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.22 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|