C23H17ClF3N3O4 — CID 22317163
[5-chloro-2-[[3-[3-(2-methyl-4-pyridinyl)phenyl]-3-oxopropanoyl]amino]-4-(trifluoromethyl)phenyl]carbamic acid (PubChem CID 22317163) has the molecular formula C23H17ClF3N3O4 and a molecular weight of 491.85 g/mol. Its IUPAC name is [5-chloro-2-[[3-[3-(2-methyl-4-pyridinyl)phenyl]-3-oxopropanoyl]amino]-4-(trifluoromethyl)phenyl]carbamic acid.
| Compound Name | [5-chloro-2-[[3-[3-(2-methyl-4-pyridinyl)phenyl]-3-oxopropanoyl]amino]-4-(trifluoromethyl)phenyl]carbamic acid |
|---|---|
| PubChem CID | 22317163 |
| Molecular Formula | C23H17ClF3N3O4 |
| Molecular Weight | 491.85 g/mol |
| Exact Mass | 491.09 |
| IUPAC Name | [5-chloro-2-[[3-[3-(2-methyl-4-pyridinyl)phenyl]-3-oxopropanoyl]amino]-4-(trifluoromethyl)phenyl]carbamic acid |
| SMILES | Cc1cc(-c2cccc(C(=O)CC(=O)Nc3cc(C(F)(F)F)c(Cl)cc3NC(=O)O)c2)ccn1 |
| InChI | InChI=1S/C23H17ClF3N3O4/c1-12-7-14(5-6-28-12)13-3-2-4-15(8-13)20(31)11-21(32)29-18-9-16(23(25,26)27)17(24)10-19(18)30-22(33)34/h2-10,30H,11H2,1H3,(H,29,32)(H,33,34) |
| InChIKey | FTMBFVDJGLMKPH-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.85 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|