C19H13ClF3N5O4 — CID 18548794
[5-chloro-2-[[3-oxo-3-[3-(1,2,4-triazol-1-yl)phenyl]propanoyl]amino]-4-(trifluoromethyl)phenyl]carbamic acid (PubChem CID 18548794) has the molecular formula C19H13ClF3N5O4 and a molecular weight of 467.79 g/mol. Its IUPAC name is [5-chloro-2-[[3-oxo-3-[3-(1,2,4-triazol-1-yl)phenyl]propanoyl]amino]-4-(trifluoromethyl)phenyl]carbamic acid.
| Compound Name | [5-chloro-2-[[3-oxo-3-[3-(1,2,4-triazol-1-yl)phenyl]propanoyl]amino]-4-(trifluoromethyl)phenyl]carbamic acid |
|---|---|
| PubChem CID | 18548794 |
| Molecular Formula | C19H13ClF3N5O4 |
| Molecular Weight | 467.79 g/mol |
| Exact Mass | 467.06 |
| IUPAC Name | [5-chloro-2-[[3-oxo-3-[3-(1,2,4-triazol-1-yl)phenyl]propanoyl]amino]-4-(trifluoromethyl)phenyl]carbamic acid |
| SMILES | O=C(O)Nc1cc(Cl)c(C(F)(F)F)cc1NC(=O)CC(=O)c1cccc(-n2cncn2)c1 |
| InChI | InChI=1S/C19H13ClF3N5O4/c20-13-6-15(27-18(31)32)14(5-12(13)19(21,22)23)26-17(30)7-16(29)10-2-1-3-11(4-10)28-9-24-8-25-28/h1-6,8-9,27H,7H2,(H,26,30)(H,31,32) |
| InChIKey | ZIRYEIHHNLOVMJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 126.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.79 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|