C23H25F3N2O5 — CID 144977386
tert-butyl N-[2-[[3-(3-methoxyphenyl)-3-oxopropanoyl]amino]-5-methyl-4-(trifluoromethyl)phenyl]carbamate (PubChem CID 144977386) has the molecular formula C23H25F3N2O5 and a molecular weight of 466.46 g/mol. Its IUPAC name is tert-butyl N-[2-[[3-(3-methoxyphenyl)-3-oxopropanoyl]amino]-5-methyl-4-(trifluoromethyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[2-[[3-(3-methoxyphenyl)-3-oxopropanoyl]amino]-5-methyl-4-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 144977386 |
| Molecular Formula | C23H25F3N2O5 |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | tert-butyl N-[2-[[3-(3-methoxyphenyl)-3-oxopropanoyl]amino]-5-methyl-4-(trifluoromethyl)phenyl]carbamate |
| SMILES | COc1cccc(C(=O)CC(=O)Nc2cc(C(F)(F)F)c(C)cc2NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C23H25F3N2O5/c1-13-9-17(28-21(31)33-22(2,3)4)18(11-16(13)23(24,25)26)27-20(30)12-19(29)14-7-6-8-15(10-14)32-5/h6-11H,12H2,1-5H3,(H,27,30)(H,28,31) |
| InChIKey | CPVJKFJVZVLGFL-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|