C21H15F3N4O4 — CID 22317290
[2-[[3-oxo-3-(3-pyridazin-3-ylphenyl)propanoyl]amino]-4-(trifluoromethyl)phenyl]carbamic acid (PubChem CID 22317290) has the molecular formula C21H15F3N4O4 and a molecular weight of 444.37 g/mol. Its IUPAC name is [2-[[3-oxo-3-(3-pyridazin-3-ylphenyl)propanoyl]amino]-4-(trifluoromethyl)phenyl]carbamic acid.
| Compound Name | [2-[[3-oxo-3-(3-pyridazin-3-ylphenyl)propanoyl]amino]-4-(trifluoromethyl)phenyl]carbamic acid |
|---|---|
| PubChem CID | 22317290 |
| Molecular Formula | C21H15F3N4O4 |
| Molecular Weight | 444.37 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | [2-[[3-oxo-3-(3-pyridazin-3-ylphenyl)propanoyl]amino]-4-(trifluoromethyl)phenyl]carbamic acid |
| SMILES | O=C(O)Nc1ccc(C(F)(F)F)cc1NC(=O)CC(=O)c1cccc(-c2cccnn2)c1 |
| InChI | InChI=1S/C21H15F3N4O4/c22-21(23,24)14-6-7-16(27-20(31)32)17(10-14)26-19(30)11-18(29)13-4-1-3-12(9-13)15-5-2-8-25-28-15/h1-10,27H,11H2,(H,26,30)(H,31,32) |
| InChIKey | MXHLJSYRAADICZ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 121.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.37 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|