C22H17F3N4O4 — CID 22317153
[2-[[3-[3-(6-methylpyridazin-3-yl)phenyl]-3-oxopropanoyl]amino]-4-(trifluoromethyl)phenyl]carbamic acid (PubChem CID 22317153) has the molecular formula C22H17F3N4O4 and a molecular weight of 458.40 g/mol. Its IUPAC name is [2-[[3-[3-(6-methylpyridazin-3-yl)phenyl]-3-oxopropanoyl]amino]-4-(trifluoromethyl)phenyl]carbamic acid.
| Compound Name | [2-[[3-[3-(6-methylpyridazin-3-yl)phenyl]-3-oxopropanoyl]amino]-4-(trifluoromethyl)phenyl]carbamic acid |
|---|---|
| PubChem CID | 22317153 |
| Molecular Formula | C22H17F3N4O4 |
| Molecular Weight | 458.40 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | [2-[[3-[3-(6-methylpyridazin-3-yl)phenyl]-3-oxopropanoyl]amino]-4-(trifluoromethyl)phenyl]carbamic acid |
| SMILES | Cc1ccc(-c2cccc(C(=O)CC(=O)Nc3cc(C(F)(F)F)ccc3NC(=O)O)c2)nn1 |
| InChI | InChI=1S/C22H17F3N4O4/c1-12-5-7-16(29-28-12)13-3-2-4-14(9-13)19(30)11-20(31)26-18-10-15(22(23,24)25)6-8-17(18)27-21(32)33/h2-10,27H,11H2,1H3,(H,26,31)(H,32,33) |
| InChIKey | SDDQLSPHMALDEJ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 121.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.40 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|