C25H24F3N5O4 — CID 22317670
[5-[methyl(propyl)amino]-2-[[3-oxo-3-(3-pyrazin-2-ylphenyl)propanoyl]amino]-4-(trifluoromethyl)phenyl]carbamic acid (PubChem CID 22317670) has the molecular formula C25H24F3N5O4 and a molecular weight of 515.49 g/mol. Its IUPAC name is [5-[methyl(propyl)amino]-2-[[3-oxo-3-(3-pyrazin-2-ylphenyl)propanoyl]amino]-4-(trifluoromethyl)phenyl]carbamic acid.
| Compound Name | [5-[methyl(propyl)amino]-2-[[3-oxo-3-(3-pyrazin-2-ylphenyl)propanoyl]amino]-4-(trifluoromethyl)phenyl]carbamic acid |
|---|---|
| PubChem CID | 22317670 |
| Molecular Formula | C25H24F3N5O4 |
| Molecular Weight | 515.49 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | [5-[methyl(propyl)amino]-2-[[3-oxo-3-(3-pyrazin-2-ylphenyl)propanoyl]amino]-4-(trifluoromethyl)phenyl]carbamic acid |
| SMILES | CCCN(C)c1cc(NC(=O)O)c(NC(=O)CC(=O)c2cccc(-c3cnccn3)c2)cc1C(F)(F)F |
| InChI | InChI=1S/C25H24F3N5O4/c1-3-9-33(2)21-12-19(32-24(36)37)18(11-17(21)25(26,27)28)31-23(35)13-22(34)16-6-4-5-15(10-16)20-14-29-7-8-30-20/h4-8,10-12,14,32H,3,9,13H2,1-2H3,(H,31,35)(H,36,37) |
| InChIKey | SIHFVWCYUUJXJP-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 124.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.49 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|