C20H20F3N3O3 — CID 55971129
tert-butyl N-[2-[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]-4-(trifluoromethyl)phenyl]carbamate (PubChem CID 55971129) has the molecular formula C20H20F3N3O3 and a molecular weight of 407.39 g/mol. Its IUPAC name is tert-butyl N-[2-[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]-4-(trifluoromethyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[2-[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]-4-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 55971129 |
| Molecular Formula | C20H20F3N3O3 |
| Molecular Weight | 407.39 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | tert-butyl N-[2-[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]-4-(trifluoromethyl)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(C(F)(F)F)cc1NC(=O)/C=C/c1cccnc1 |
| InChI | InChI=1S/C20H20F3N3O3/c1-19(2,3)29-18(28)26-15-8-7-14(20(21,22)23)11-16(15)25-17(27)9-6-13-5-4-10-24-12-13/h4-12H,1-3H3,(H,25,27)(H,26,28)/b9-6+ |
| InChIKey | XKQFQOFDDSHSNJ-RMKNXTFCSA-N |
| XLogP | 5.10 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.39 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|