C24H17F6N3O2 — CID 88558688
N-[4-methyl-3-[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]phenyl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 88558688) has the molecular formula C24H17F6N3O2 and a molecular weight of 493.41 g/mol. Its IUPAC name is N-[4-methyl-3-[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]phenyl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[4-methyl-3-[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]phenyl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 88558688 |
| Molecular Formula | C24H17F6N3O2 |
| Molecular Weight | 493.41 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | N-[4-methyl-3-[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]phenyl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1NC(=O)/C=C/c1cccnc1 |
| InChI | InChI=1S/C24H17F6N3O2/c1-14-4-6-19(12-20(14)33-21(34)7-5-15-3-2-8-31-13-15)32-22(35)16-9-17(23(25,26)27)11-18(10-16)24(28,29)30/h2-13H,1H3,(H,32,35)(H,33,34)/b7-5+ |
| InChIKey | ZSNRHPIYVXXLBO-FNORWQNLSA-N |
| XLogP | 6.33 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.41 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|