C23H16F6N4O2 — CID 75282030
N-[4-methyl-3-(3-pyrimidin-5-ylprop-2-enoylamino)phenyl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 75282030) has the molecular formula C23H16F6N4O2 and a molecular weight of 494.40 g/mol. Its IUPAC name is N-[4-methyl-3-(3-pyrimidin-5-ylprop-2-enoylamino)phenyl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[4-methyl-3-(3-pyrimidin-5-ylprop-2-enoylamino)phenyl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 75282030 |
| Molecular Formula | C23H16F6N4O2 |
| Molecular Weight | 494.40 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | N-[4-methyl-3-(3-pyrimidin-5-ylprop-2-enoylamino)phenyl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1NC(=O)C=Cc1cncnc1 |
| InChI | InChI=1S/C23H16F6N4O2/c1-13-2-4-18(9-19(13)33-20(34)5-3-14-10-30-12-31-11-14)32-21(35)15-6-16(22(24,25)26)8-17(7-15)23(27,28)29/h2-12H,1H3,(H,32,35)(H,33,34) |
| InChIKey | KHONJIDAJDIEOD-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.40 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|