C17H13F6NO — CID 2094760
N-(2,5-dimethylphenyl)-3,5-bis(trifluoromethyl)benzamide (PubChem CID 2094760) has the molecular formula C17H13F6NO and a molecular weight of 361.29 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-(2,5-dimethylphenyl)-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 2094760 |
| Molecular Formula | C17H13F6NO |
| Molecular Weight | 361.29 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | N-(2,5-dimethylphenyl)-3,5-bis(trifluoromethyl)benzamide |
| SMILES | Cc1ccc(C)c(NC(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C17H13F6NO/c1-9-3-4-10(2)14(5-9)24-15(25)11-6-12(16(18,19)20)8-13(7-11)17(21,22)23/h3-8H,1-2H3,(H,24,25) |
| InChIKey | UKCLROOIONIEGU-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.29 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |