C16H10ClF6NO2 — CID 18684513
N-(5-chloro-4-hydroxy-2-methylphenyl)-3,5-bis(trifluoromethyl)benzamide (PubChem CID 18684513) has the molecular formula C16H10ClF6NO2 and a molecular weight of 397.70 g/mol. Its IUPAC name is N-(5-chloro-4-hydroxy-2-methylphenyl)-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-(5-chloro-4-hydroxy-2-methylphenyl)-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 18684513 |
| Molecular Formula | C16H10ClF6NO2 |
| Molecular Weight | 397.70 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | N-(5-chloro-4-hydroxy-2-methylphenyl)-3,5-bis(trifluoromethyl)benzamide |
| SMILES | Cc1cc(O)c(Cl)cc1NC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H10ClF6NO2/c1-7-2-13(25)11(17)6-12(7)24-14(26)8-3-9(15(18,19)20)5-10(4-8)16(21,22)23/h2-6,25H,1H3,(H,24,26) |
| InChIKey | MYDRPHPQKUWZIY-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.70 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|