C18H13F6NO3 — CID 46530264
methyl 4-[[3,5-bis(trifluoromethyl)benzoyl]amino]-3-methylbenzoate (PubChem CID 46530264) has the molecular formula C18H13F6NO3 and a molecular weight of 405.29 g/mol. Its IUPAC name is methyl 4-[[3,5-bis(trifluoromethyl)benzoyl]amino]-3-methylbenzoate.
| Compound Name | methyl 4-[[3,5-bis(trifluoromethyl)benzoyl]amino]-3-methylbenzoate |
|---|---|
| PubChem CID | 46530264 |
| Molecular Formula | C18H13F6NO3 |
| Molecular Weight | 405.29 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | methyl 4-[[3,5-bis(trifluoromethyl)benzoyl]amino]-3-methylbenzoate |
| SMILES | COC(=O)c1ccc(NC(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c(C)c1 |
| InChI | InChI=1S/C18H13F6NO3/c1-9-5-10(16(27)28-2)3-4-14(9)25-15(26)11-6-12(17(19,20)21)8-13(7-11)18(22,23)24/h3-8H,1-2H3,(H,25,26) |
| InChIKey | KXLNCQFFORJAEL-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.29 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |