C14H15N3O3 — CID 63997003
methyl 3-methyl-4-[(5-methyl-1H-pyrazole-4-carbonyl)amino]benzoate (PubChem CID 63997003) has the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. Its IUPAC name is methyl 3-methyl-4-[(5-methyl-1H-pyrazole-4-carbonyl)amino]benzoate.
| Compound Name | methyl 3-methyl-4-[(5-methyl-1H-pyrazole-4-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 63997003 |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | methyl 3-methyl-4-[(5-methyl-1H-pyrazole-4-carbonyl)amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)c2cn[nH]c2C)c(C)c1 |
| InChI | InChI=1S/C14H15N3O3/c1-8-6-10(14(19)20-3)4-5-12(8)16-13(18)11-7-15-17-9(11)2/h4-7H,1-3H3,(H,15,17)(H,16,18) |
| InChIKey | GAOFJFQBOPZHHO-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |