C16H11F6NO3S — CID 55487840
N-(2-methylsulfonylphenyl)-3,5-bis(trifluoromethyl)benzamide (PubChem CID 55487840) has the molecular formula C16H11F6NO3S and a molecular weight of 411.32 g/mol. Its IUPAC name is N-(2-methylsulfonylphenyl)-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-(2-methylsulfonylphenyl)-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 55487840 |
| Molecular Formula | C16H11F6NO3S |
| Molecular Weight | 411.32 g/mol |
| Exact Mass | 411.04 |
| IUPAC Name | N-(2-methylsulfonylphenyl)-3,5-bis(trifluoromethyl)benzamide |
| SMILES | CS(=O)(=O)c1ccccc1NC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H11F6NO3S/c1-27(25,26)13-5-3-2-4-12(13)23-14(24)9-6-10(15(17,18)19)8-11(7-9)16(20,21)22/h2-8H,1H3,(H,23,24) |
| InChIKey | GKZCYTPAKYZZML-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.32 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |