C18H20N2O7S — CID 55535206
4-(2-amino-2-oxoethoxy)-3,5-dimethoxy-N-(2-methylsulfonylphenyl)benzamide (PubChem CID 55535206) has the molecular formula C18H20N2O7S and a molecular weight of 408.43 g/mol. Its IUPAC name is 4-(2-amino-2-oxoethoxy)-3,5-dimethoxy-N-(2-methylsulfonylphenyl)benzamide.
| Compound Name | 4-(2-amino-2-oxoethoxy)-3,5-dimethoxy-N-(2-methylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 55535206 |
| Molecular Formula | C18H20N2O7S |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 4-(2-amino-2-oxoethoxy)-3,5-dimethoxy-N-(2-methylsulfonylphenyl)benzamide |
| SMILES | COc1cc(C(=O)Nc2ccccc2S(C)(=O)=O)cc(OC)c1OCC(N)=O |
| InChI | InChI=1S/C18H20N2O7S/c1-25-13-8-11(9-14(26-2)17(13)27-10-16(19)21)18(22)20-12-6-4-5-7-15(12)28(3,23)24/h4-9H,10H2,1-3H3,(H2,19,21)(H,20,22) |
| InChIKey | HBVIUIXHHOWWGL-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 134.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |