C18H19NO7S — CID 8728892
methyl 3-methoxy-4-[2-(2-methylsulfonylanilino)-2-oxoethoxy]benzoate (PubChem CID 8728892) has the molecular formula C18H19NO7S and a molecular weight of 393.42 g/mol. Its IUPAC name is methyl 3-methoxy-4-[2-(2-methylsulfonylanilino)-2-oxoethoxy]benzoate.
| Compound Name | methyl 3-methoxy-4-[2-(2-methylsulfonylanilino)-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 8728892 |
| Molecular Formula | C18H19NO7S |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | methyl 3-methoxy-4-[2-(2-methylsulfonylanilino)-2-oxoethoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCC(=O)Nc2ccccc2S(C)(=O)=O)c(OC)c1 |
| InChI | InChI=1S/C18H19NO7S/c1-24-15-10-12(18(21)25-2)8-9-14(15)26-11-17(20)19-13-6-4-5-7-16(13)27(3,22)23/h4-10H,11H2,1-3H3,(H,19,20) |
| InChIKey | POYFJKDLHNXSGA-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |