C19H22N2O5 — CID 9243234
4-(2-amino-2-oxoethoxy)-N-(2,4-dimethylphenyl)-3,5-dimethoxybenzamide (PubChem CID 9243234) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is 4-(2-amino-2-oxoethoxy)-N-(2,4-dimethylphenyl)-3,5-dimethoxybenzamide.
| Compound Name | 4-(2-amino-2-oxoethoxy)-N-(2,4-dimethylphenyl)-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 9243234 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 4-(2-amino-2-oxoethoxy)-N-(2,4-dimethylphenyl)-3,5-dimethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(C)cc2C)cc(OC)c1OCC(N)=O |
| InChI | InChI=1S/C19H22N2O5/c1-11-5-6-14(12(2)7-11)21-19(23)13-8-15(24-3)18(16(9-13)25-4)26-10-17(20)22/h5-9H,10H2,1-4H3,(H2,20,22)(H,21,23) |
| InChIKey | PISFEZKAVRIOIM-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |