C18H14F6N2O2 — CID 39233175
N-[2-(dimethylcarbamoyl)phenyl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 39233175) has the molecular formula C18H14F6N2O2 and a molecular weight of 404.31 g/mol. Its IUPAC name is N-[2-(dimethylcarbamoyl)phenyl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[2-(dimethylcarbamoyl)phenyl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 39233175 |
| Molecular Formula | C18H14F6N2O2 |
| Molecular Weight | 404.31 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | N-[2-(dimethylcarbamoyl)phenyl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | CN(C)C(=O)c1ccccc1NC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H14F6N2O2/c1-26(2)16(28)13-5-3-4-6-14(13)25-15(27)10-7-11(17(19,20)21)9-12(8-10)18(22,23)24/h3-9H,1-2H3,(H,25,27) |
| InChIKey | OIMAATOFFJYMOK-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.31 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |