C16H15F3N2O3S — CID 25494632
N,N-dimethyl-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]benzamide (PubChem CID 25494632) has the molecular formula C16H15F3N2O3S and a molecular weight of 372.37 g/mol. Its IUPAC name is N,N-dimethyl-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]benzamide.
| Compound Name | N,N-dimethyl-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]benzamide |
|---|---|
| PubChem CID | 25494632 |
| Molecular Formula | C16H15F3N2O3S |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | N,N-dimethyl-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]benzamide |
| SMILES | CN(C)C(=O)c1ccccc1NS(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H15F3N2O3S/c1-21(2)15(22)13-8-3-4-9-14(13)20-25(23,24)12-7-5-6-11(10-12)16(17,18)19/h3-10,20H,1-2H3 |
| InChIKey | HBTIRGIXOQKNSU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |