C27H21F3N2O3S — CID 2333973
N-benzhydryl-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]benzamide (PubChem CID 2333973) has the molecular formula C27H21F3N2O3S and a molecular weight of 510.54 g/mol. Its IUPAC name is N-benzhydryl-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]benzamide.
| Compound Name | N-benzhydryl-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]benzamide |
|---|---|
| PubChem CID | 2333973 |
| Molecular Formula | C27H21F3N2O3S |
| Molecular Weight | 510.54 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | N-benzhydryl-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]benzamide |
| SMILES | O=C(NC(c1ccccc1)c1ccccc1)c1ccccc1NS(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H21F3N2O3S/c28-27(29,30)21-14-9-15-22(18-21)36(34,35)32-24-17-8-7-16-23(24)26(33)31-25(19-10-3-1-4-11-19)20-12-5-2-6-13-20/h1-18,25,32H,(H,31,33) |
| InChIKey | ZHYQAIJRMAKAIV-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.54 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |