C15H8ClF6NO2 — CID 71508594
N-(5-chloro-2-hydroxyphenyl)-3,5-bis(trifluoromethyl)benzamide (PubChem CID 71508594) has the molecular formula C15H8ClF6NO2 and a molecular weight of 383.68 g/mol. Its IUPAC name is N-(5-chloro-2-hydroxyphenyl)-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-(5-chloro-2-hydroxyphenyl)-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 71508594 |
| Molecular Formula | C15H8ClF6NO2 |
| Molecular Weight | 383.68 g/mol |
| Exact Mass | 383.01 |
| IUPAC Name | N-(5-chloro-2-hydroxyphenyl)-3,5-bis(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1cc(Cl)ccc1O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H8ClF6NO2/c16-10-1-2-12(24)11(6-10)23-13(25)7-3-8(14(17,18)19)5-9(4-7)15(20,21)22/h1-6,24H,(H,23,25) |
| InChIKey | XFKHDOHWIMSKRX-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.68 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|