C14H9Cl2NO4 — CID 56581240
7-chloro-N-(5-chloro-2-hydroxyphenyl)-1,3-benzodioxole-5-carboxamide (PubChem CID 56581240) has the molecular formula C14H9Cl2NO4 and a molecular weight of 326.14 g/mol. Its IUPAC name is 7-chloro-N-(5-chloro-2-hydroxyphenyl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | 7-chloro-N-(5-chloro-2-hydroxyphenyl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 56581240 |
| Molecular Formula | C14H9Cl2NO4 |
| Molecular Weight | 326.14 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | 7-chloro-N-(5-chloro-2-hydroxyphenyl)-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(Nc1cc(Cl)ccc1O)c1cc(Cl)c2c(c1)OCO2 |
| InChI | InChI=1S/C14H9Cl2NO4/c15-8-1-2-11(18)10(5-8)17-14(19)7-3-9(16)13-12(4-7)20-6-21-13/h1-5,18H,6H2,(H,17,19) |
| InChIKey | LYQDRIILFAKCFS-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.14 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|