C11H8ClN3O3 — CID 61393952
7-chloro-N-(1H-pyrazol-5-yl)-1,3-benzodioxole-5-carboxamide (PubChem CID 61393952) has the molecular formula C11H8ClN3O3 and a molecular weight of 265.66 g/mol. Its IUPAC name is 7-chloro-N-(1H-pyrazol-5-yl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | 7-chloro-N-(1H-pyrazol-5-yl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 61393952 |
| Molecular Formula | C11H8ClN3O3 |
| Molecular Weight | 265.66 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | 7-chloro-N-(1H-pyrazol-5-yl)-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(Nc1ccn[nH]1)c1cc(Cl)c2c(c1)OCO2 |
| InChI | InChI=1S/C11H8ClN3O3/c12-7-3-6(4-8-10(7)18-5-17-8)11(16)14-9-1-2-13-15-9/h1-4H,5H2,(H2,13,14,15,16) |
| InChIKey | RNXZNCQUXKXEBQ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.66 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |