C15H13ClN2O3 — CID 9480093
7-chloro-N'-methyl-N'-phenyl-1,3-benzodioxole-5-carbohydrazide (PubChem CID 9480093) has the molecular formula C15H13ClN2O3 and a molecular weight of 304.73 g/mol. Its IUPAC name is 7-chloro-N'-methyl-N'-phenyl-1,3-benzodioxole-5-carbohydrazide.
| Compound Name | 7-chloro-N'-methyl-N'-phenyl-1,3-benzodioxole-5-carbohydrazide |
|---|---|
| PubChem CID | 9480093 |
| Molecular Formula | C15H13ClN2O3 |
| Molecular Weight | 304.73 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 7-chloro-N'-methyl-N'-phenyl-1,3-benzodioxole-5-carbohydrazide |
| SMILES | CN(NC(=O)c1cc(Cl)c2c(c1)OCO2)c1ccccc1 |
| InChI | InChI=1S/C15H13ClN2O3/c1-18(11-5-3-2-4-6-11)17-15(19)10-7-12(16)14-13(8-10)20-9-21-14/h2-8H,9H2,1H3,(H,17,19) |
| InChIKey | YRRSHBNMSOODMH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.73 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|