C20H15ClN2O3 — CID 51184964
7-chloro-N-[phenyl(pyridin-2-yl)methyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 51184964) has the molecular formula C20H15ClN2O3 and a molecular weight of 366.80 g/mol. Its IUPAC name is 7-chloro-N-[phenyl(pyridin-2-yl)methyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | 7-chloro-N-[phenyl(pyridin-2-yl)methyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 51184964 |
| Molecular Formula | C20H15ClN2O3 |
| Molecular Weight | 366.80 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 7-chloro-N-[phenyl(pyridin-2-yl)methyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(NC(c1ccccc1)c1ccccn1)c1cc(Cl)c2c(c1)OCO2 |
| InChI | InChI=1S/C20H15ClN2O3/c21-15-10-14(11-17-19(15)26-12-25-17)20(24)23-18(13-6-2-1-3-7-13)16-8-4-5-9-22-16/h1-11,18H,12H2,(H,23,24) |
| InChIKey | JGUVJRKCOOGKSF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.80 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |