C15H10ClN3O3 — CID 34334265
N-(benzimidazol-1-yl)-7-chloro-1,3-benzodioxole-5-carboxamide (PubChem CID 34334265) has the molecular formula C15H10ClN3O3 and a molecular weight of 315.72 g/mol. Its IUPAC name is N-(benzimidazol-1-yl)-7-chloro-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-(benzimidazol-1-yl)-7-chloro-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 34334265 |
| Molecular Formula | C15H10ClN3O3 |
| Molecular Weight | 315.72 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | N-(benzimidazol-1-yl)-7-chloro-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(Nn1cnc2ccccc21)c1cc(Cl)c2c(c1)OCO2 |
| InChI | InChI=1S/C15H10ClN3O3/c16-10-5-9(6-13-14(10)22-8-21-13)15(20)18-19-7-17-11-3-1-2-4-12(11)19/h1-7H,8H2,(H,18,20) |
| InChIKey | XKDUANMVYVXZPG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.72 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |