C19H17ClN2O3 — CID 24554019
7-chloro-N-(3-indol-1-ylpropyl)-1,3-benzodioxole-5-carboxamide (PubChem CID 24554019) has the molecular formula C19H17ClN2O3 and a molecular weight of 356.81 g/mol. Its IUPAC name is 7-chloro-N-(3-indol-1-ylpropyl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | 7-chloro-N-(3-indol-1-ylpropyl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 24554019 |
| Molecular Formula | C19H17ClN2O3 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 7-chloro-N-(3-indol-1-ylpropyl)-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(NCCCn1ccc2ccccc21)c1cc(Cl)c2c(c1)OCO2 |
| InChI | InChI=1S/C19H17ClN2O3/c20-15-10-14(11-17-18(15)25-12-24-17)19(23)21-7-3-8-22-9-6-13-4-1-2-5-16(13)22/h1-2,4-6,9-11H,3,7-8,12H2,(H,21,23) |
| InChIKey | BJUMFBOMRFCNJA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|