C15H20ClN3O3 — CID 119394256
7-chloro-N-(3-piperazin-1-ylpropyl)-1,3-benzodioxole-5-carboxamide (PubChem CID 119394256) has the molecular formula C15H20ClN3O3 and a molecular weight of 325.80 g/mol. Its IUPAC name is 7-chloro-N-(3-piperazin-1-ylpropyl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | 7-chloro-N-(3-piperazin-1-ylpropyl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 119394256 |
| Molecular Formula | C15H20ClN3O3 |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 7-chloro-N-(3-piperazin-1-ylpropyl)-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(NCCCN1CCNCC1)c1cc(Cl)c2c(c1)OCO2 |
| InChI | InChI=1S/C15H20ClN3O3/c16-12-8-11(9-13-14(12)22-10-21-13)15(20)18-2-1-5-19-6-3-17-4-7-19/h8-9,17H,1-7,10H2,(H,18,20) |
| InChIKey | DAOFYCDZKULHMF-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|