C18H25ClN2O3 — CID 55716363
7-chloro-N-[4-(4-methylpiperidin-1-yl)butyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 55716363) has the molecular formula C18H25ClN2O3 and a molecular weight of 352.86 g/mol. Its IUPAC name is 7-chloro-N-[4-(4-methylpiperidin-1-yl)butyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | 7-chloro-N-[4-(4-methylpiperidin-1-yl)butyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 55716363 |
| Molecular Formula | C18H25ClN2O3 |
| Molecular Weight | 352.86 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 7-chloro-N-[4-(4-methylpiperidin-1-yl)butyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | CC1CCN(CCCCNC(=O)c2cc(Cl)c3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C18H25ClN2O3/c1-13-4-8-21(9-5-13)7-3-2-6-20-18(22)14-10-15(19)17-16(11-14)23-12-24-17/h10-11,13H,2-9,12H2,1H3,(H,20,22) |
| InChIKey | PUTCLJOQOPHCQG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.86 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|