C22H22N4O — CID 55437340
N-(3-indol-1-ylpropyl)-2,3-dimethylquinoxaline-6-carboxamide (PubChem CID 55437340) has the molecular formula C22H22N4O and a molecular weight of 358.45 g/mol. Its IUPAC name is N-(3-indol-1-ylpropyl)-2,3-dimethylquinoxaline-6-carboxamide.
| Compound Name | N-(3-indol-1-ylpropyl)-2,3-dimethylquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 55437340 |
| Molecular Formula | C22H22N4O |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | N-(3-indol-1-ylpropyl)-2,3-dimethylquinoxaline-6-carboxamide |
| SMILES | Cc1nc2ccc(C(=O)NCCCn3ccc4ccccc43)cc2nc1C |
| InChI | InChI=1S/C22H22N4O/c1-15-16(2)25-20-14-18(8-9-19(20)24-15)22(27)23-11-5-12-26-13-10-17-6-3-4-7-21(17)26/h3-4,6-10,13-14H,5,11-12H2,1-2H3,(H,23,27) |
| InChIKey | GOGQKXLHWIKRIH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|