C23H26I2N2O2 — CID 22237561
4-hydroxy-N-(8-indol-1-yloctyl)-3,5-diiodobenzamide (PubChem CID 22237561) has the molecular formula C23H26I2N2O2 and a molecular weight of 616.28 g/mol. Its IUPAC name is 4-hydroxy-N-(8-indol-1-yloctyl)-3,5-diiodobenzamide.
| Compound Name | 4-hydroxy-N-(8-indol-1-yloctyl)-3,5-diiodobenzamide |
|---|---|
| PubChem CID | 22237561 |
| Molecular Formula | C23H26I2N2O2 |
| Molecular Weight | 616.28 g/mol |
| Exact Mass | 616.01 |
| IUPAC Name | 4-hydroxy-N-(8-indol-1-yloctyl)-3,5-diiodobenzamide |
| SMILES | O=C(NCCCCCCCCn1ccc2ccccc21)c1cc(I)c(O)c(I)c1 |
| InChI | InChI=1S/C23H26I2N2O2/c24-19-15-18(16-20(25)22(19)28)23(29)26-12-7-3-1-2-4-8-13-27-14-11-17-9-5-6-10-21(17)27/h5-6,9-11,14-16,28H,1-4,7-8,12-13H2,(H,26,29) |
| InChIKey | AEVSHUNTIVMHBO-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.28 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|