C20H23N3O3S — CID 2489290
4-(dimethylsulfamoyl)-N-(3-indol-1-ylpropyl)benzamide (PubChem CID 2489290) has the molecular formula C20H23N3O3S and a molecular weight of 385.49 g/mol. Its IUPAC name is 4-(dimethylsulfamoyl)-N-(3-indol-1-ylpropyl)benzamide.
| Compound Name | 4-(dimethylsulfamoyl)-N-(3-indol-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 2489290 |
| Molecular Formula | C20H23N3O3S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 4-(dimethylsulfamoyl)-N-(3-indol-1-ylpropyl)benzamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(C(=O)NCCCn2ccc3ccccc32)cc1 |
| InChI | InChI=1S/C20H23N3O3S/c1-22(2)27(25,26)18-10-8-17(9-11-18)20(24)21-13-5-14-23-15-12-16-6-3-4-7-19(16)23/h3-4,6-12,15H,5,13-14H2,1-2H3,(H,21,24) |
| InChIKey | AQLYUOIMCBVACF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|