C20H17ClN2O4 — CID 56534843
7-chloro-N-(3-quinolin-8-yloxypropyl)-1,3-benzodioxole-5-carboxamide (PubChem CID 56534843) has the molecular formula C20H17ClN2O4 and a molecular weight of 384.82 g/mol. Its IUPAC name is 7-chloro-N-(3-quinolin-8-yloxypropyl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | 7-chloro-N-(3-quinolin-8-yloxypropyl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 56534843 |
| Molecular Formula | C20H17ClN2O4 |
| Molecular Weight | 384.82 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 7-chloro-N-(3-quinolin-8-yloxypropyl)-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(NCCCOc1cccc2cccnc12)c1cc(Cl)c2c(c1)OCO2 |
| InChI | InChI=1S/C20H17ClN2O4/c21-15-10-14(11-17-19(15)27-12-26-17)20(24)23-8-3-9-25-16-6-1-4-13-5-2-7-22-18(13)16/h1-2,4-7,10-11H,3,8-9,12H2,(H,23,24) |
| InChIKey | BDFCTTDNIWAUPJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.82 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|