C21H22N2O2S — CID 56535021
2-methyl-5-methylsulfanyl-N-(3-quinolin-8-yloxypropyl)benzamide (PubChem CID 56535021) has the molecular formula C21H22N2O2S and a molecular weight of 366.49 g/mol. Its IUPAC name is 2-methyl-5-methylsulfanyl-N-(3-quinolin-8-yloxypropyl)benzamide.
| Compound Name | 2-methyl-5-methylsulfanyl-N-(3-quinolin-8-yloxypropyl)benzamide |
|---|---|
| PubChem CID | 56535021 |
| Molecular Formula | C21H22N2O2S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 2-methyl-5-methylsulfanyl-N-(3-quinolin-8-yloxypropyl)benzamide |
| SMILES | CSc1ccc(C)c(C(=O)NCCCOc2cccc3cccnc23)c1 |
| InChI | InChI=1S/C21H22N2O2S/c1-15-9-10-17(26-2)14-18(15)21(24)23-12-5-13-25-19-8-3-6-16-7-4-11-22-20(16)19/h3-4,6-11,14H,5,12-13H2,1-2H3,(H,23,24) |
| InChIKey | ZPPJRPISBJYBDQ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|