C19H17IN2O2 — CID 56535258
4-iodo-N-(3-quinolin-8-yloxypropyl)benzamide (PubChem CID 56535258) has the molecular formula C19H17IN2O2 and a molecular weight of 432.26 g/mol. Its IUPAC name is 4-iodo-N-(3-quinolin-8-yloxypropyl)benzamide.
| Compound Name | 4-iodo-N-(3-quinolin-8-yloxypropyl)benzamide |
|---|---|
| PubChem CID | 56535258 |
| Molecular Formula | C19H17IN2O2 |
| Molecular Weight | 432.26 g/mol |
| Exact Mass | 432.03 |
| IUPAC Name | 4-iodo-N-(3-quinolin-8-yloxypropyl)benzamide |
| SMILES | O=C(NCCCOc1cccc2cccnc12)c1ccc(I)cc1 |
| InChI | InChI=1S/C19H17IN2O2/c20-16-9-7-15(8-10-16)19(23)22-12-3-13-24-17-6-1-4-14-5-2-11-21-18(14)17/h1-2,4-11H,3,12-13H2,(H,22,23) |
| InChIKey | RWISUGVXZIJODZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.26 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|