C23H24ClN3O3 — CID 56535280
4-chloro-N-[4-oxo-4-(3-quinolin-8-yloxypropylamino)butyl]benzamide (PubChem CID 56535280) has the molecular formula C23H24ClN3O3 and a molecular weight of 425.92 g/mol. Its IUPAC name is 4-chloro-N-[4-oxo-4-(3-quinolin-8-yloxypropylamino)butyl]benzamide.
| Compound Name | 4-chloro-N-[4-oxo-4-(3-quinolin-8-yloxypropylamino)butyl]benzamide |
|---|---|
| PubChem CID | 56535280 |
| Molecular Formula | C23H24ClN3O3 |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 4-chloro-N-[4-oxo-4-(3-quinolin-8-yloxypropylamino)butyl]benzamide |
| SMILES | O=C(CCCNC(=O)c1ccc(Cl)cc1)NCCCOc1cccc2cccnc12 |
| InChI | InChI=1S/C23H24ClN3O3/c24-19-11-9-18(10-12-19)23(29)27-14-3-8-21(28)25-15-4-16-30-20-7-1-5-17-6-2-13-26-22(17)20/h1-2,5-7,9-13H,3-4,8,14-16H2,(H,25,28)(H,27,29) |
| InChIKey | BPJJLAOZLCXWTF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|