C23H23F2N3O3 — CID 56585771
2,4-difluoro-N-[4-oxo-4-(3-quinolin-8-yloxypropylamino)butyl]benzamide (PubChem CID 56585771) has the molecular formula C23H23F2N3O3 and a molecular weight of 427.45 g/mol. Its IUPAC name is 2,4-difluoro-N-[4-oxo-4-(3-quinolin-8-yloxypropylamino)butyl]benzamide.
| Compound Name | 2,4-difluoro-N-[4-oxo-4-(3-quinolin-8-yloxypropylamino)butyl]benzamide |
|---|---|
| PubChem CID | 56585771 |
| Molecular Formula | C23H23F2N3O3 |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 2,4-difluoro-N-[4-oxo-4-(3-quinolin-8-yloxypropylamino)butyl]benzamide |
| SMILES | O=C(CCCNC(=O)c1ccc(F)cc1F)NCCCOc1cccc2cccnc12 |
| InChI | InChI=1S/C23H23F2N3O3/c24-17-9-10-18(19(25)15-17)23(30)28-12-3-8-21(29)26-13-4-14-31-20-7-1-5-16-6-2-11-27-22(16)20/h1-2,5-7,9-11,15H,3-4,8,12-14H2,(H,26,29)(H,28,30) |
| InChIKey | QNMCLNJZTSFQRD-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|