C23H20F2N4O2 — CID 86949236
3-(2,4-difluorophenyl)-1-methyl-N-(3-quinolin-8-yloxypropyl)pyrazole-4-carboxamide (PubChem CID 86949236) has the molecular formula C23H20F2N4O2 and a molecular weight of 422.44 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)-1-methyl-N-(3-quinolin-8-yloxypropyl)pyrazole-4-carboxamide.
| Compound Name | 3-(2,4-difluorophenyl)-1-methyl-N-(3-quinolin-8-yloxypropyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 86949236 |
| Molecular Formula | C23H20F2N4O2 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 3-(2,4-difluorophenyl)-1-methyl-N-(3-quinolin-8-yloxypropyl)pyrazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)NCCCOc2cccc3cccnc23)c(-c2ccc(F)cc2F)n1 |
| InChI | InChI=1S/C23H20F2N4O2/c1-29-14-18(22(28-29)17-9-8-16(24)13-19(17)25)23(30)27-11-4-12-31-20-7-2-5-15-6-3-10-26-21(15)20/h2-3,5-10,13-14H,4,11-12H2,1H3,(H,27,30) |
| InChIKey | SQNAIMLGQWPNNU-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|