C19H20BrN3O2 — CID 56585571
4-bromo-1-ethyl-N-(3-quinolin-8-yloxypropyl)pyrrole-2-carboxamide (PubChem CID 56585571) has the molecular formula C19H20BrN3O2 and a molecular weight of 402.29 g/mol. Its IUPAC name is 4-bromo-1-ethyl-N-(3-quinolin-8-yloxypropyl)pyrrole-2-carboxamide.
| Compound Name | 4-bromo-1-ethyl-N-(3-quinolin-8-yloxypropyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 56585571 |
| Molecular Formula | C19H20BrN3O2 |
| Molecular Weight | 402.29 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | 4-bromo-1-ethyl-N-(3-quinolin-8-yloxypropyl)pyrrole-2-carboxamide |
| SMILES | CCn1cc(Br)cc1C(=O)NCCCOc1cccc2cccnc12 |
| InChI | InChI=1S/C19H20BrN3O2/c1-2-23-13-15(20)12-16(23)19(24)22-10-5-11-25-17-8-3-6-14-7-4-9-21-18(14)17/h3-4,6-9,12-13H,2,5,10-11H2,1H3,(H,22,24) |
| InChIKey | LRJBMRPMZVVWCT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.29 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|