C26H31N3O3 — CID 56585451
4-tert-butyl-N-[1-oxo-1-(3-quinolin-8-yloxypropylamino)propan-2-yl]benzamide (PubChem CID 56585451) has the molecular formula C26H31N3O3 and a molecular weight of 433.55 g/mol. Its IUPAC name is 4-tert-butyl-N-[1-oxo-1-(3-quinolin-8-yloxypropylamino)propan-2-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[1-oxo-1-(3-quinolin-8-yloxypropylamino)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 56585451 |
| Molecular Formula | C26H31N3O3 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | 4-tert-butyl-N-[1-oxo-1-(3-quinolin-8-yloxypropylamino)propan-2-yl]benzamide |
| SMILES | CC(NC(=O)c1ccc(C(C)(C)C)cc1)C(=O)NCCCOc1cccc2cccnc12 |
| InChI | InChI=1S/C26H31N3O3/c1-18(29-25(31)20-11-13-21(14-12-20)26(2,3)4)24(30)28-16-7-17-32-22-10-5-8-19-9-6-15-27-23(19)22/h5-6,8-15,18H,7,16-17H2,1-4H3,(H,28,30)(H,29,31) |
| InChIKey | MAQWBNKOBXSMMD-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|